PREMIER SECONDARY SCHOOL 4. The role of women in overall development has not been fully understood.

5. Educational system should not be used to transform the traditional attitudes.

New Baneshwor,
DASHAIN HOME WORK – 2081 C. Pick 5ut words from the passage which mean the same as each of the following: 5
Class: -XII Management 1. Cruel and unfair.
Subject: - English - A 2. Remove
Attempt all the Questions 3. Exclude
1 Read the following passage and answer the Questions below based on it. 4. Power given to someone to do something.
Today’s woman is a highly self-directed person, alive to the sense of her dignity and the 5. Convert into a new thing
importance of her functions in the private domestic domain and the public domain of the
world of work. Women are rational in approach, careful in handling situations and want to 2. Write Short answers to the following Questions 2x5=10
do things as best as possible. The Fourth World Conference of Women held in Beijing in i. Can Wisdom be taught? If so how?(Knowledge and Wisdom)
September 1995 had highlighted that no enduring solution of society’s most threatening ii. What does the line “News like Squirrel ran” mean in the poem.(A Day)
social, economic and political problems could be found without the participation and iii. Sketch the character of Gouvernail and contrast it with Gatson.(A Respectable
empowerment of the women. The 1995 World Summit for Social Development had also Women)
emphasized the essential role of women in eliminating poverty and mending the social fabric iv. Who are the old guards? Why did they grow desperate?(I Was My Own Route)
v. Do you call Rakesh a devoted son? Give Reasons.( A Devoted Son)
The Constitution of Nepal had discussed on women equal rights and opportunities political,
social, and educational and of employment with men. Because of oppressive traditions, 3. Write long answers to the following Questions 5x2=10
superstitions, exploitation and corruption, a majority of women are not allowed to enjoy the i. The author says “I was not a god student, but I was a good learner” Justify your
rights and opportunities, bestowed on them. One of the major reasons for this state of affairs answer. (On Libraries)
is the lack of literacy and awareness among women. Education is the main instrument through ii. Justify “Marriage as a Social Institution” How are marriages in Nepalese society
which we can narrow down the prevailing inequality and accelerate the process of economic different from Western society?(Marriage as a Social Institution)
and political change in the status of women. OR
iii. A Nepali proverb says “Neighbors are companions for wedding procession as well as
The role of women in a society is very important. Women’s education is the key to a better life for funeral procession” Explain.
in the future. A recent World Bank study says that educating girls is not a charity, it is good 4. Write a couple of paragraphs elaborating the idea of 3Rs (Reduce, Reuse, Recycle) in
economics and if developing nations are to eradicate poverty, they must educate the girls. The Garbage Management 7.
report says that the economic and social returns on investment in education of the girls 5. Prepare one News Report On the topic of your choice 8
considerably affect the human development index of the nation. Society would progress only 6. Write an essay on “The Importance of Family” (Write in about 300 words) 10
if the status of women is respected and the presence of an educated woman in the family would 7 Do as indicated in the Brackets and rewrite the sentences. 10x1=10
ensure education of the family itself. Education and empowerment of women are closely i. The cat sat lazily on the dirty mat. (underline the adverb)
related. The role of women in overall development has not been fully understood nor has it ii. The boys goes to the cinema every Saturday. ( into Interrogative sentence)
been given its full weight in the struggle to eliminate poverty, hunger, injustice and inequality iii. Is tomorrow is a public holiday?………..( Question Tag)
at the national level. Even when we are at the 21st century, our society still discriminates iv. The cake, baked by my grandmother,……………..(is/was/were )delicious.
against women in matters of their rights and privileges and prevents them from participating v. This knife is sharp. You can cut the bread with it. ( Use Connectives)
in the process of national and societal progress. vi. Ram is rich. He doesn’t have his own car. ( Despite/ In spite of)
The educational system is the only institution which can counteract the deep foundations of vii. They have been waiting…………….twelve o’clock.(Preposition)
inequality that are built in the minds of people through the socialization process. Education is viii. They didn’t have enough money…... she decided to save more.(Conjunction)
the most important instrument of human resource development. Educational system should be ix. This is the book ……..cover is torn. ( whose, which’s , who’s)
used to transform the traditional attitudes and inculcate new values of equality. x. I was drinking milk when I ……… a loud noise. (Correct Verb).
8. Do as Instructed 5x1=5
A Answer the following Questions [1x5=5] i. They aren’t staying in this hotel any more. They ……………(checked out,
1. Mention any two qualities of a modern woman checked in, Checked off)
2. Why are women’s participation and empowerment considered necessary? ii. Write the word with prefix “ ability”
3. What does World Bank study says about educating girls? iii. In which quarter of the dictionary do you find the following words
4. What has The Constitution of Nepal discussed for women’s Right? (a) discipline ( b) narrative (c) tragedy (d) ginger
5. How is education the most important instrument of human resource development? iv. Price Seem to …………..every year. ( Rise/ raise/ raised)
B Write True or False after reading the Sentences [1x5=5] v. Make a suitable sentence from the word.
1. Today’s woman is a person alive to the sense of her dignity. “ Memorable”
2. The 1995 World Summit for Social Development emphasized the essential role of
women in eliminating poverty and mending the social fabric. Best of Luck.
3. Women’s education is the key to a better life in the future.
 3. consciously and intentionally.
Subject: - English - B 4. struggle without weapons
Attempt all the Questions 5. supporting democracy and its principles.
1 Read the following passage and answer the Questions below based on it. 2. Give short answers to the following Questions 5x2=10
In today’s digital age, information is more accessible than ever before. With a single click, 1. Do you think Rakesh was a responsible son? How? A Devoted Son)
we can find answers to almost any question, read breaking news, or watch a live event 2. Why is Gatson surprised with his wife’s expression towards the end of the story?
happening across the globe. However, this wealth of information has its downsides. One (A Respectable women)
of the most significant concerns is the spread of misinformation and disinformation. 3. How does famous actress make a fool of the Earnest Young Women?( A Matter
Misinformation refers to false or misleading information spread unintentionally, while of Husbands)
disinformation is deliberately false information spread with the intent to deceive. Social 4. What according to the speaker, is “A Day’? (A DAY)
media platforms, in particular, have become hotbeds for misinformation. Many users 5. Differentiate between “Knowledge and Wisdom”. (Knowledge and Wisdom)
share articles or news stories without verifying their authenticity, leading to the rapid 3 Write long answers to the following questions. 2x5=10
1. Write the summary of the play “A Matter of Husbands”
spread of false information. This is often exacerbated by the phenomenon known as "echo
2. According to the essay “Nothing is pleasanter than exploring a Library” do you
chambers"—online spaces where users are exposed only to opinions that reinforce their agree? Why?
own beliefs, limiting their exposure to different viewpoints. OR
Governments and organizations around the world are grappling with how to combat this 3. What are the Dimensions that define normative marriage?
issue. Some have introduced fact-checking initiatives, while others have imposed stricter 4 Write a couple of paragraphs describing the sports event you have witnessed? 7
regulations on the content shared online. Nevertheless, the responsibility also lies with 5 Write a newspaper article on “The Status of “Roads in Nepal”. 8
individuals to ensure they critically evaluate the information they consume. Developing 6 Write an essay on “Care of Orphans” in about 300 words 10
7 Do as indicated in the brackets and rewrite the sentences. 1x10=10
media literacy—understanding how to analyze and evaluate information—is crucial in
1 It’s going to rain soon………………………… (Tag Question)
today’s world. 2. He is an Introvert, who has ……………….friends. (Much/few/more)
The impact of misinformation is not limited to trivial matters. It can have severe 3. She sent him an invitation. (Change into Interrogative)
consequences, particularly in areas like politics, public health, and security. For 4. He opened the door………….a key. (provide Preposition)
instance, during the COVID-19 pandemic, the spread of false information about cures, 5. Give me………….. money, I owe you. ( Provide Article)
vaccines, and the virus itself led to widespread confusion and, in some cases, dangerous 6. The cold breeze blew ………………… on her face ( appropriate adverb)
behavior. In politics, misinformation has influenced elections and policy decisions, 7. It rained heavily. We enjoyed our holiday.
8. Could you pour me …………….water please? ( Many/ few/ some)
sometimes undermining the democratic process itself. 9. In Nepal many girls get married……….an early age. ( provide Preposition)
In conclusion, while the digital revolution has undoubtedly transformed the way we 10. Your father never touched alcoholic drinks ….,………………. ( Question Tag)
access and share information, it has also brought challenges that need addressing. 8 Do as Instructed 5.
Tackling misinformation requires a multifaceted approach that includes regulation,
1. Make suitable sentence from the word” infrastructure”
education, and personal responsibility.
2. My car …………………While I was driving. ( broke up/ broke off/ broke
A. Answer the following Questions: 5x1=5 down/ broke in)
1. What is the difference between misinformation and disinformation? 3. Price seem to……………every year. ( raise/ rise/ rose)
2. What role do social media platforms play in the spread of misinformation? 4. I think the problem is ……………than it seems. ( complicated/ tough/ hard)
3. Why is media literacy important in the digital age? 5. Form any two words using the suffix “ ness”
4. What does the author suggest as a solution to the problem of misinformation? i) ……………… ii)……………………
5. How has misinformation influenced politics, according to the passage?
B. Choose the correct words from the passage and fill the Blanks. 1x5=5 Best of Luck.
1. Social media platforms, in particular, have become ………for misinformation.
2. Misinformation refers …………. information spread unintentionally.
3. Organizations around the world are ……….with how to combat this issue.
4. The digital revolution has undoubtedly …………the way we access
5. The ………. of information has its downsides.
C . Write the meanings from the passage. 1x5=5
1. able to be reached or entered.
2. the negative aspect of something
 lk|ldo/ df=lj= dfgjn] cfˆgf] hLjg gj kfiff0f o'udf k'¥ofof] . o; ;dodf dfgjn] s[lifsd{ ckgfpg yfln
gofFafg]Zj/, sf7df8f}F ;s]sf] lyof] .
bz}+ u[xsfo{ –@)*! k|Zgx¿
sIff M !@ Joj:yfkg c= g]kfnsf pkTosfx¿df slt jif{ klxn] hª\un pTkGg ePsf] lyof] <
ljifo M clgjfo{ g]kfnL ;d"x s cf= cflb dfgj oL pkTosfdf k:g'cl3 oxfF s:tf] jftfj/0f lyof] <
gf]6 M eflifs z'4tf, ;/;kmfO / df}lns pQ/nfO{ cª\s lbFbf ljz]if k|f]T;fxg lbOg] 5 . O= dfgjn] lsg ofofj/Lo hLjg latfpg'k¥of] <
;a} k|Zgx¿sf] pQ/ lbg'xf];\ . O{= dfgjn] s'g o'udf s[lifsd{ ;'? u¥of] <
!= tnsf zAbsf] cIf/ ;+/rgf / cIf/ ;ª\Vof;d]t b]vfpg'xf];\ M -#_ p= cg'R5]bsf] klxnf] jfSo ;/n, ;+o'Qm, ld> s'\g xf] <
ljz]if, ljBfyL{, g]kfn !!= tnsf] cg'R5]baf6 d'Vo d'Vo rf/ a'Fbf l6kL Ps t[tLof+zdf ;f/f+z n]Vg'xf];\ M -@±#Ö%_
@= z'4 u/L k'gn]{vg ug'{xf];\ M -#_ ;flxTodf er'{cn oyfy{ ;fOa/ hutn] cufl8 NofPsf] oyfy{sf] gofF :j¿k xf] . er'{cndf
æt];f] t cxd efasf sf/g 5f]/fx¿n] …dbt lnGgÚ eg]sf xf]Ogg, w]/}h;f] dbtuf/x¿n] jf:tljstf 5]lnPsf] x'G5 eg] jf:tljstf k|lt:yflkt eP/ 5fofn] Tof] :yfg lnPsf] x'G5 .
dbtsf] af6f] ul/ lng]x¿sf hLGbludf xdnf u/]/ 8/fPsf dfq} x'g .Æ ntdfofn]] elgg . s'g} l:j|mgdf b]lvPsf lj|mofsnfknfO{ b]v]/ ;To 7fg]/ cfgGb dfGg' er'{cn oyfy{ xf] . ;fOa/
#= lbOPsf] cg'R5]baf6 Pp6f pvfg / Pp6f 6'Ssf klxrfg u/L ltgnfO{ jfSodf k|of]u ug'{xf];\ ;+:s[ltsf sf/0f jf:tljstf 5]lnPsf] 5 cyf{t\ jf:tljstf k|lt:yflkt eP/ 5fofn] Tof] 7fpF
M-@_ lnPsf] 5 . ;fOa/ :k];df /x]sf s'/fsf] nflu ;fOa/ ;~hfnsf dfWod k|of]u;Fu} sDKo'6/sf
ufpFsf dflg;x¿ lhpFbfsf] hGtL / dbf{sf] dnfdL eg]e}Fm x/]s ;'vb'Mvdf Pscsf{nfO{ kbf{df b]lvPsf s'/fdf ljZjf; ug]{ pQ/cfw'lgs ;fOa/Lo dfGotfsf] cfwf/df k|To]s j:t'sf
emsf{]kmsf]{ gu/L ;xof]u u5{g\ . c¿sf s'/f sf6\geGbf kl5;Dd emnemnL ofb cfpg] u/]/ htftt} 5fof dfq pknAw x'g] ePsfn] jf:tljs / cjf:tljs larsf] leGgtf x/fPsf] 5 .
;'? ul/Psf sfdx¿nfO{ Psn] y'sL ;'sL ;on] y'sL gbL eGg] s'/fnfO{ dgg u/L lbnf] Hofg er'{cn oyfy{nfO{ dflg;x¿ k|ToIf ¿kdf 5'g, rfVg, ;'£g ;St}gg\ t/ klg ltgLx¿nfO{ ;To
lbP/ sfd u5{g\. 7fG5g\ . ;fOa/ ;~hfnaf6 ul/Psf er'{cn ;+:s[ltdf k|ToIf ¿kdf 5'g / ;'£g g;Sg'
$= tnsf] cg'R5]baf6 /]vfª\sg ul/Psf zAbsf] zAbju{ klxrfg u/L n]Vg'xf];\ M -#_ ;Lldttf eP klg ;fOa/ :k];af6 u'dfPsf cgluGtL s'/fx¿ ;fª\s]lts ¿kdf k|fKt ug{
ltdLn] s] sfd u¥of} / dnfO{ s] nufof} eGb} c;fdfGo ¿kdf l/;fPsf] efOn] …lwSsf/ 5 ltd|f] ;lsG5 . ;~hfn leq cfa4 eP/ cGtlj|{mof ug]{, k|ToIf ¿kdf e]63f6 eP/ cGtlj|{mof ug{
hLjg Û eGg klg afFsL /fv]g . ;Dej ePsf] 5 . @! cf}F ztfAbLdf dflg;x¿n] ;fOa/ :k];sf] k|of]u u/]/ w]/}eGbf w]/} /f]dflG6s
%= lbOPsf] cg'R5]baf6 b'O{ b'O{ cf]6f tT;d / cfuGt's zAb klxrfg u/L n]Vg'xf];\ M -@_ s'/fx¿ ug{ ;Dej ePsf] 5 .
Pp6L cfOdfO{nfO{ cf}ifwL lkofO lbPF, Pp6f afnsnfO{ c:ktfn k'¥ofP/ kms]{, ltg hgfnfO{ :s'ndf !@= lbbLsf] lax]sf lglDt ufpF hfg'kg{] ePsf] x'gfn] tLg lbgsf] labf kfpmF egL ljBfnosf
5f]l8 lbPF, a'‰of} dfg] Û ;+;f/nfO{ v'a rnfO{ lbg], ;f/f dg'ionfO{ v';L t'Nofpg] . k|frfo{nfO{ Pp6f lgj]bg n]Vg'xf];\ . -$_
^= tn lbOPsf pk;u{ / k|Tooaf6 Ps Ps zAb agfO{ lgdf{0f k|lj|mof klg b]vfpg'xf];\ M -#_ !#= …a]/f]huf/L M ;d:of / ;dfwfgÚ zLif{sdf !%) zAbdf g36fO{ Pp6f l6Kk0fL n]Vg'xf];\ . -%_
pk;u{ – ;', cg', ;d\ !$= tnsf] p4/0fsf] JofVof ug{'xf];\ . -$_
k|Too – O{g, cgLo, Os Æx]/f}Fnf, Tof] x'/L eP/ cfpg] 5,
&= jfSo 9fFrf;lxt PsjrgnfO{ ax'jrgdf kl/jt{g u/L k'gn]{vg ug'{xf];\ M -$_ ltdL kft eP/ k5\ofpg] 5f} .Æ
d sf7df8f+}sf] gofF afg]Zj/df a:5' . l5d]sdf d]/f] Ps hgf dg ldNbf] ;fyL 5 . ;fyL dnfO{ !%= lbOPsf] syf+z k9L ;f]lwPsf k|Zgsf] pQ/ n]Vg'xf];\ M -$_
dfof dfq xf]Og, ;xof]u klg u5{ . d lbgx'F pm;Fu k':tsfno hfG5' . sfnf]lgnf] cfsfzdf pQ/lt/ w'|jtf/f To;sf] bflxg]lt/ ;fttf/f / b]a|]lt/ kfFr tf/fsf pHofnf
*= pRr cfb/df ¿kfGt/0f u/L lbOPsf] cg'R5]b k'gn]{vg ug'{xf];\ M -$_ tf/fd08nn] ltgnfO{ df]lxt t'Nofof] . k"j{b]lv klZrdlt/ s]xL blIf0flt/ 9lNsPsf] cfsfzuª\uf
tF ldlxg]tL 5;\ . t]/f] afgLa]xf]/f klg /fd|f] 5 . t]/f] k9fO klg /fd|f] 5 . hf];'s}nfO{ ljZjf; bdoGtLsf b[li6df ;ª\uLtdo x'g yfNof] . cfsfz / k[YjL o:tf ;'Gb/ 5g\ . ltgsf lar cfk"m
ul/xfNg] afgLdf eg] t}Fn] ;'wf/ ug'{k5{ . PSnL lj/lx0fL cj:yfdf cg'ej u/]/ bdoGtL sf]dn dw'/ :j/df ljof]u / kL8fsf] uLt ufpg
(= lbOPsf jfSonfO{ s/0f eP cs/0f / cs/0f eP s/0fdf kl/0ft u/L k'gn{]vg ug{'xf];\ . -$_ yflng\ . slta]/;Dd ltgn] uLt ufOg\, ltgn] cfk}m yfxf kfOgg\ . cfsfzdf la:tf/} la:tf/}
pm ;a}nfO{ dg k/fpF5 . ltdL laxfg} 3/ uPg5f} . kfgL k¥of] eg] afnL ;lk|G5 . pgLx¿nfO{ ple|P/ cfpFb} kftnf afbnn] Tof] ;'Gb/ cfsfznfO{ bdoGtLsf Åbodf w"ldn t'NofpFb} nUof] .
cfˆgf] b]zsf] dfof lyof] . Kf|Zgx¿ M
!)= lbOPsf] cg'R5]b k9L ;f]lwPsf k|Zgsf] 5f]6f] pQ/ lbg'xf];\ M -%_ c= dflysf] cg'R5]bdf s:tf] kl/j]zsf] lrq0f ul/Psf] 5 <
g]kfnsf] d]rLb]lv dxfsfnL;Ddsf] e"efudf cg]s pkTosf kfOG5g\ . ;'b"/ klZrdsf] ;'v{]t cf= cfsfz / bdoGtLsf Åbosf lar s] ;dfgtf 5 <
pkTosf, bfª / b]pv'/L pkTosf, kf]v/f pkTosf, lrtjg, gjnk'/ pkTosf, sf7df8f}F !^= ofqfdf ;xefuLn] s:tf ;d:ofsf] ;fdgf ug{'k¥of] < æ3g3:ofsf] psfnf] sf6\tfÆ lgofqfsf
pkTosf, l;Gw'nL df8L pkTosf / c¿ gbL lsgf/sf cg]s pkTosf 5g\ . e"ue{j]Qf cfwf/df rrf{ ug{'xf];\ . -$_
ljåfg\x¿sf] egfOcg';f/ oL pkTosfdf klxn] hn el/Psf] lyof] / sl/a c9fO{ nfv jif{ klxn] !&= æPs lrxfgÆ pkGof;df g]kfnL ;dfhsf] s:tf] cj:yfsf] lrq0f ul/Psf] 5 < -*_
oL pkTosfaf6 kfgL lg:s]/ aflx/ uof] . ;DejtM oL ;a} pkTosfsf] kfgL To;kl5 g} v'Nof] !*= tn lbOPsfdWo] s'g} Ps zLif{sdf @%) zAbdf g36fO{ lgaGw n]Vg'xf];\ M -*_
. kfgL au]/ uPkl5 oxfF hª\un eof] / hLjhGt' klg cfˆgf] cfxf/fsf] vf]hLdf o;tk{m cu|;/ s= d]/f] b]z M d]/f] klxrfg v= hLjgdf lzIffsf] dxTTj
eP . To;kl5 cflb dfgj klg cfˆgf] hLjg lgjf{xsf nflu o;tk{m l;sf/ ug{ k:of] . klxn] u= g]kfnsf] hn;Dkbf / cfly{s ljsf;
dfgjsf] hLjg ofofj/Lo eP klg kl5 s]xL l:y/ x'Fb} uof] . cfheGbf bz xhf/ jif{ klxn];Dd •••••
dfgj k'/fg} kfiff0f o'usf] j|mddf lyof] . t/ O;fk"j{ ;ft xhf/b]lv kfFr xhf/ jif{lt/ cfP/
sIff M !@ Joj:yfkg
 sIffM !@ Joj:yfkg g]kfnsf] d]rLb]lv dxfsfnL;Ddsf] e"efudf cg]s pkTosf kfOG5g\ . ;'b"/
ljifo M clgjfo{ g]kfnL
;d"x v klZrdsf] ;'v{]t pkTosf, bfª / b]pv'/L pkTosf, kf]v/f pkTosf, lrtjg,
;a} k|Zgx¿sf] pQ/ lbg'xf];\ . gjnk'/ pkTosf, sf7df8f}F pkTosf, l;Gw'nL df8L pkTosf / c¿ gbLlsgf/sf
!= tnsf zAbsf] cIf/ ;+/rgf / cIf/ ;ª\Vof;d]t b]vfpg'xf];\ M-#_ cg]s pkTosf 5g\ . e"ue{j]Qf ljåfg\x¿sf] egfOcg';f/ oL pkTosfdf klxn]
sGof, ;fdflhs, ljz]iftf hn el/Psf] lyof] / sl/a c9fO{ nfv jif{klxn] oL pkTosfaf6 kfgL lg:s]/
@= z'4 u/L k'gn]{vg ug'{xf];\ M -#_ aflx/ uof] . ;DejtM oL ;a} pkTosfsf] kfgL To;kl5 g} v'Nof] . kfgL au]/
Plt w]/} k8]/ klg ;fyLx? l;t s;/L Joaxf/ ug'{ k5{ eGg] s'/f hfg]sf /lxg5f}F . uPkl5 oxfF hª\un eof] / hLjhGt' klg cfˆgf] cfxf/fsf] vf]hLdf o;tk{m cu|;/
#= lbOPsf] cg'R5]baf6 Pp6f cg's/0ffTds zAb / Pp6f pvfg klxrfg u/L eP . To;kl5 cflbdfgj klg cfˆgf] hLjglgjf{xsf nflu o;tk{m l;sf/ ug{
ltgnfO{ jfSodf k|of]u ug'{xf];\ M-@_
k:of] . klxn] dfgjsf] hLjg ofofj/Lo eP klg kl5 s]xL l:y/ x'Fb} uof] . cfheGbf
ufpFsf dflg;x¿ lhpFbfsf] hGtL / dbf{sf] dnfdL eg]e}Fm x/]s ;'vb'Mvdf
Pscsf{nfO{ emsf{]kmsf]{ gu/L ;xof]u u5{g\ . c¿sf s'/f sf6\geGbf kl5;Dd bz xhf/ jif{klxn] ;Dd dfgj k'/fg} kfiff0f o'usf] j|mddf lyof] t/ O;fk"j{ ;ft
emnemnL ofb cfpg] u/]/ ;'? ul/Psf sfdx¿nfO{ Psn] y'sL ;'sL ;on] y'sL xhf/b]lv kfFr xhf/ jif{lt/ cfP/ dfgjn] cfˆgf] hLjg gj kfiff0f o'udf k'¥ofof]
gbL eGg] s'/fnfO{ dgg u/L lbnf] Hofg lbP/ sfd u5{g\ . . o; ;dodf dfgjn] s[lifsd{ ckgfpg yfln;s]sf] lyof] .
$= /]vfª\sg ul/Psf zAbx¿sf] kbju{ klxrfg u/L n]Vg'xf];\ M-#_ k|Zgx¿ M
:ofaf; Û sfG5f 5f]/f Û ltdLn] /fd|f];Fu k9]/ sIff P3f/sf] k/LIffdf ;jf]{Ts[i6 eO{ s= g]kfnsf pkTosfx¿df slt jif{klxn] hª\un pTkGg ePsf] lyof] <
s'nsf] OHht a9fof} . sfG5fnfO{ w]/} w]/} wGojfb 5 . v= cflbdfgj oL pkTosfdf k:g'cl3 oxfF s:tf] jftfj/0f lyof] <
%= lbOPsf] cg'R5]baf6 b'O{ b'O{ cf]6f tT;d / cfuGt's zAb klxrfg u/L u= dfgjn] lsg ofofj/Lo hLjg latfpg'k¥of] <
n]Vg'xf];\ M-@_ 3= dfgjn] s'g o'udf s[lifsd{ ;'? u¥of] <
sDKo'6/ Ps On]S6«f]lgs oGq xf] h;n] cToGt} pRr j]udf k|of]ustf{n] lbPsf]
lgb]{zgcg';f/ sfo{ ;Dkfbg u/L glthf k|:t'tug{ / 8f6f e08f/0f ug{ ;S5 . ª= …kfiff0f’ zAbsf] cy{ s] xf] <
^= tn lbOPsf] cg'R5]baf6 tLgcf]6f pk;u{ / tLgcf]6f k|Too nfu]sf zAbx¿ !!= tnsf] cg'R5]baf6 d'Vo d'Vo rf/ a'Fbf l6kL Ps t[tLof+zdf ;f/f+z
klxrfg u/L lgdf{0f k|lj|mof klg b]vfpg'xf];\ M -#_ n]Vg'xf];\ M-@±#Ö%_
of]Uotfsf] sb/ gx'g] 7fpFdf ;'of]Uo JolSt klg bl08t x'G5 . lzlIft / r]tgzLn ;flxTodf er'{cn oyfy{ ;fOa/ hut\n] cufl8 NofPsf] oyfy{sf] gofF :j¿k xf]
gful/sx¿ gfnfosaf6 kLl8t 5g\ . b'Jo{jxf/n] ;HhgnfO{ klg b'h{g agfpF5 . . er'{cndf jf:tljstf 5]lnPsf] x'G5 eg] jf:tljstfk|lt :yflkt eP/ 5fofn]
&= tnsf] cg'R5]bsf jfSonfO{ k'lnª\u eP :qLlnª\u / :qLlnª\u eP k'lnª\udf Tof] :yfg lnPsf] x'G5 . s'g} l:j|mgdf b]lvPsf lj|mofsnfknfO{ b]v]/ ;To 7fg]/
kl/jt{g u/L k'gn]{vg ug'{xf];\ M-$_ cfgGb dfGg' er'{cn oyfy{ xf] . ;fOa/ ;+:s[ltsf sf/0f jf:tljstf 5]lnPsf] 5
7'nLcfdf rf}tf/f]df zLtn tflk/xg'ePsf] lyof] . 7'nfaf klg ToxL cfOk'Ug'eP5 cyf{t\ jf:tljstfk|lt :yflkt eP/ 5fofn] Tof] 7fpF lnPsf] 5 . ;fOa/ :k];df
. d]/L alxgL klg ToxLF cfP/ a;L . efO klg ToxLF cfof] . /x]sf s'/fsf] nflu ;fOa/ ;~hfnsf dfWod k|of]u;Fu} sDKo'6/sf kbf{df b]lvPsf
*= dWod cfb/df ¿kfGt/0f u/L lbOPsf] cg'R5]b k'gn]{vg ug'{xf];\ M -$_ s'/fdf ljZjf; ug]{ pQ/cfw'lgs ;fOa/Lo dfGotfsf] cfwf/df k|To]s j:t'sf
tF ldlxg]tL 5;\ . t]/f] afgLa]xf]/f klg /fd|f] 5 . t]/f] k9fO klg /fd|f] 5 . hf];'s}nfO{ htftt} 5fof dfq pknAw x'g] ePsfn] jf:tljs / cjf:tljslarsf] leGgtf
ljZjf; ul/xfNg] afgLdf eg] t}Fn] ;'wf/ ug'{k5{ . x/fPsf] 5 . er'{cn oyfy{nfO{ dflg;x¿ k|ToIf ¿kdf 5'g, rfVg, ;'£g ;St}gg\
(= lbOPsf] cg'R5]bnfO{ ;ª\ult ldnfO{ k'gn]{vg ug'{xf];\ M -$_ t/ klg ltgLx¿nfO{ ;To 7fG5g\ . ;fOa/ ;~hfnaf6 ul/Psf er'{cn ;+:s[ltdf
d]/L 5f]/f ;fg} l5g\ . ltd|L 5f]/f klg ;fg} l5g\ . d]/f] 5f]/L ljBfnodf k9\5g\ . k|ToIf ¿kdf 5'g / ;'£g g;Sg' ;Lldttf eP klg ;fOa/ :k];af6 u'dfPsf
ltd|f] 5f]/L klg ljBfnodf k9\5g\ cgluGtL s'/fx¿ ;fª\s]lts ¿kdf k|fKt ug{ ;lsG5 . ;~hfnleq cfa4 eP/
!)= lbOPsf] cg'R5]b k9L ;f]lwPsf k|Zgsf] 5f]6f] pQ/ lbg'xf];\ M -%_ cGtlj|{mof ug]{, k|ToIf ¿kdf e]63f6 eP/ cGtlj|{mof ug{ ;Dej ePsf] 5 . @!
 cf}F ztfAbLdf dflg;x¿n] ;fOa/ :k];sf] k|of]u u/]/ w]/}eGbf w]/} /f]dflG6s s'/fx¿
ug{ ;Dej ePsf] 5 .
!@= sf]/f]gf efO/; lj?4sf] vf]k nufpg ;DemfpFb} ufpFdf a:g] cfdfnfO{ Pp6f lr7L
n]Vg'xf];\ . -$_
!#= …a9\bf] dxFuL M ;d:of / ;dfwfgÚ zLif{sdf !%) zAbdf g36fO{ Pp6f l6Kk0fL
n]Vg'xf];\ . -%_
!$= JofVof ug'{xf];\ M -$_
…gf/L k|]d / ;ª\3if{sf k|ltd"lt{ x'g\ .Ú
!%= tnsf] sljtf+z k9L ;f]lwPsf k|Zgsf] pQ/ n]Vg'xf];\ M -$_
cfdf, Tof] cfpF5 / <
æxf], af, Tof] cfpF5
Tof] laxfgsf] ;"o{e}Fm pHofnf] 5b}{ cfpF5
To;sf] sDd/df 6lNsPsf] zLt h:t} 6Nsg]
ltdL Ps xltof/ b]Vg] 5f}
To;}n] pm cwd{l;t n8\g] 5
Tof] cfpFbf ltdL klxn] t ;kgfxf] ls eg]/
5fd5'd ug]{ 5f} t/ Tof] lxpF / cfuf]eGbf klg
a9\tf 5f]Og] eP/ cfpF5 .Æ
k|Zgx¿
c= lsg j|mflGtsf] cfjZostf k/]sf] xf] <
cf= …Tof] lxpF / cfuf]eGbf klg a9\tf 5f]Og] eP/ cfpF5Ú eGg'sf] tfTko{ s] xf]<
!^= ef}uf]lns cj:yf / ;fdflhs kl/j]zsf b[li6n] …3g3:ofsf] psfnf] sf6\tfÚ
lgofqf tkfO{FnfO{ s:tf] NffUof] <k|ltlqmof lbg'xf];\ .-$_
!&= …Ps lrxfgÚ pkGof;df g]kfnL ;dfhsf] s:tf] cj:yfsf] lrq0f ul/Psf] 5 <
ljZn]if0f ug'{xf];\ . -*_
!*= tn lbOPsf dWo] s'g} Ps zLif{sdf @%) zAbdf g36fO{ lgaGw n]Vg'xf];\ M-*_
s= d]/f] hGde"ld
v= :j:y hLjgsf /x:o
u= ;dosf] dxTTj
•••••
 3.Explain L’Hospitals rule and write its characterstics.
[4*1=4]

Class: - 12 Management Set A 4.The edge of a cube increases from 10 cm to 10.01 cm .Find the approximate
Subject: Basic Maths
increments in the surface area of the cube.Also find the actual increments
1.In regression analysis ,both variables must have and the percentage error in the approximation.
[4*1=4]
a)same units b)different units c)both a and b d)none
2.If correlation coefficient is positive then the slope of regression line 5.Show that the equation of tangent and normal to the curve x2-y2=7 at (4,-3).
a)positive b)negative c)both a and b d)0
[4*1=4]
3.The tangent to the curve is parallel to x-axis if
a)m=1 b)m=-1 c)m=0 d)m=2 6.Water flows in to an inverted conical tank at the rate of 24 cu.cm/min .How
4.The derivative of sinh2x w.r.t x is fast is level rising when the depth of water is 9 cm.The height of tank is 15 cm
a)2cosh2x b)-sinhx c)cosh2x 2sinh2x and radius at top is 5 cm.
[4*1=4]
5.The term commonly used in circle is
a)centre b)radius c)circumference d)all of the 7.Find the equations of tangents drawn to the circle from the points (11,3) to
above the circle x2+y2=65.Also find the angle between the tangents.
6.The square of iota is
[4*1=4]
a)1 b)-0.1 c)-1 d)12
7.If the circumference of the circle increases at a constant rate,the the area 8.Derive the general equation of tangent to the circle
a)increases at constant rate b)decreases at constant rate
[4*1=4]
c)increases proportional to radius d)decreases inversely as the
radius 9.Solve: Z6+1=0
8.The correlation between two variables may be
[4*1=4]
a)Positive or negative b)simple or partial
c)linear or parabolic d)all of the above 10.Determine the cube roots of -1
9.Tangent at a point and radius drawn are
[3*1=3]
a)parallel b)orthogonal c)both d)none
10.The euler form of complex number i is 11.Explain De-Moivre’s Theorem.
a)ei b)eiπ/2 c) sin0 d)cos0
[4*1=4]
11.The slope of tangent to the curve y=2x2-3 at x=-1 in degree is
a) 0 b)45 c)90 d)270 12.Prove that c=a cosB+b cosC

[4*1=4]
Long Questions:
1.Find the derivative of (sinh(X/a))x^2 13.Prove sin(A+B)=sinA.cosB+cosA.sinB
[4*1=4]
[4*1=4]
2.Evaluate Lim Log(tanx)/logx
[4*1=4]

X->0
14.The marks obtained by 8 students in Math and Physics are given below

[4*1=4]

Marks in Math 40 60 35 68 70 96 70 84
Marks in Physics 48 62 28 52 85 90 52 73
Find the rank correlation coefficient between marks in Math and Physics.
15.A lot containing 9 items of which 3 are defective.Two items are choosen
from the lot at random one after another without replacement.Find the
probability that
[4*1=4]

i.both of them are defective ii.both of them are non-

defective
iii.first is defective and second not

16. .Find the regression equation of x on y from the following data

[3*1=3]

X: 5 9 13 17 21
Y: 3 8 13 18 23
17.Solve by cramer’s rule
[4*1=4]

2x-y+4z=-3
x-4z=5
6x-y+2z=10

Best of Luck
 Sub: - Mathematics - B 19.Find the area of triangle formed by points A(1,1,1),B(1,2,3) and C(2,3,1) by vector
Multiple choice questions: (11x1=11) method. [5*1=5]
1.The slope of tangent to the curve y=2x2-3 at x=-1 in degree is Long Questions: (8x3=24)
a) 0 b)45 c)90 d)270 20.a.Explain L’hospitals rule and explain it’s characterstics. [2]
2.If the circumference of the circle increases at a constant rate,the the area b.The edge of a cube increases from 10 cm to 10.025 cm .Find the approximate
a)increases at constant rate b)decreases at constant rate increments in the volume and surface area of the cube.Also find the actual
c)increases proportional to radius d)decreases inversely as the radius increments and the percentage error in the approximation. [3]
(𝑒 𝑥 −1)𝑡𝑎𝑛𝑥
3.The tangent to the curve is parallel to x-axis if c. Find the derivatives lim [3]
𝑥→0 𝑥2
a)m=1 b)m=-1 c)m=0 d)m=2
21 a.The marks obtained by 8 students in Math and Physics are given below [3]
4.The derivative of sinh2x w.r.t x is
Marks in Math 40 60 35 68 70 96
a)2cosh2x b)-sinhx c)cosh2x 2sinh2x
70 84
5.The correlation between two variables may be
Marks in Physics 48 62 28 52 85 90
a)Positive or negative b)simple or partial c)linear or parabolic
52 73
d)all of the above
Find the rank correlation coefficient between marks in Math and Physics.
6.In regression analysis ,both variables must have
b.Find the regression equation of x on y from the following data
a)same units b)different units c)both a and b d)none
X: 5 9 13 17 21
7.If correlation coefficient is positive then the slope of regression line
Y: 3 8 13 18 23
a)positive b)negative c)both a and b d)0
Also find the value of x when y =25
8.The term commonly used in circle is
[3+2]
a)centre b)radius c)circumference d)all of the above
22a.Solve by Row equivalent matrix method:
9.Tangent at a point and radius drawn are
[3]
a)parallel b)orthogonal c)both d)none
2x-y+z=-1, x-2y+3z=4, 4x+y+2z=4
10.The euler form of complex number i is
b.Explain Cramer’s rule with examples.
a)ei b)eiπ/2 c) sin0 d)cos0
[2]
11.The square of iota is
c. lot containing 9 items of which 3 are defective.Two items are choosen from
a)1 b)-0.1 c)-1 d)12
the lot at random one after another without replacement.Find the probability
Short Questions: (8x5=40)
that [3]
12 a.Find the derivative of XSinh^2(X/a)
i.both of them are defective ii.both of them are non-defective
[3]
iii.first is defective and second not
b. Sinh2x + cosh2x
………………….
[2]
log⁡(𝑡𝑎𝑛𝑥)
13 Evaluate. lim
𝑥→0 𝑙𝑜𝑔𝑥
[5*1=5]
14 a.Find the point on the curve y=3x2+4x-5 where the tangent is parallel to the line
16x+2y=3. [2.5]
b. Find the value of K so that the line 4x+3y+k = 0 may touch the circle
x2+y2-4x + 10y +4 = 0 (2.5)
15.A spherical ball of salt is dissolving in water in such a way that rate of decrease in
volume at any instant is proportional to surface,How is the radius decreasing?
[5*1=5]
16a.Prove that the straight line y=x+a√2 touches the circle x2+y2=a2 also find the point
of contact. [2.5]
b. Prove a2=b2+c2-2bc cosA by Vector method [2.5]
17.Derive the condition of tangency of a straight line to a circle. [5*1=5]
18.Find the square roots of 2=2+2√3 i [5*1=5]
 Class: - 12 Science (PHY) Set A a. 25 cm b. 50 cm c. 75 cm d. 100 cm
9. Which of the following instrument is used to measure e.m.f. of a
Candidates are required to give their answers in their own words as far as cell accurately?
practicable. a. voltmeter b. ammeter c. potentiometer d. Slide wire
The figures in the margin indicate full marks. bridge
10. What is the interval when a sound is reflected beck from a distance
Group A (Multiple Choice Questions) (1 x 11 = 11) object and hits our ears?
a. 0.1sec b.0.8sec c. 0.4sec d. 0.5sec
1. The wavelength of the wave following the equation of sound wave
11. According to Bohr’s atom model, in which of the following
𝑦 = ⁡0.0015⁡𝑆𝑖𝑛⁡(62.4⁡𝑥⁡ + ⁡316⁡𝑡) is
transition will the frequency be maximum?
a. 0.2unit b. 0.1unit c. 0.3unit d. undetermined
a. n=2 to n=1 b. n=3 to n=2
2. By whom of the following infrasonic sound is produce?
c. n=4 to n=3 d. n=2 to n= ∞
a. porpoises b. dolphins c. Elephants d. Bats
Group B (Short Answer Questions) (8 x 5 = 40)
3. The average velocity of particle executing SHM in one complete
vibration is 12. a. Define angular momentum and write its SI unit.
𝐴𝑊 𝐴𝑊 2
a. 2 b. 0 c. 2 d. [2]
None of the above b. A ballet dancer spins about a vertical axis 1 revolution per
4. An The ratio of frequencies in the following figures (a), (b) and second with her arms stretched. When the moment of inertia
(c) is about the axis of rotation is I. with her arms folded the moment of
inertia about the axis decreases by 40%. Calculate the new
rotation of revolution. [3]
13. .a. Write any one special character of simple harmonic motion.
[1]
b. Obtain an expression for time period of simple pendulum.
[3]
c. What is the effective length of the second’s pendulum?
Given g = 9.8 m/s2
5. The center of mass of body [1]
a. lies inside the body b. lies outside the 14. a. Define capillarity and angle of contact.
body always [2]
c. lies on the surface the body d. None of the b. On what factors does it depend?
options. [1]
6. If the polar ice caps melt and spread uniformly then the length of c. The surface tension of ethanol at 30 ºC is 2.189 X 10-2 N m-1 and
day its density = 0.780 g/cc. To what height will this liquid rise in a
a. 24 hrs. b. more than 24 hrs. c. less than 24 hrs. d. 12 capillary tube of radius 0.002 cm? What pressure is needed to push
hrs. the meniscus level back with the surrounding liquid?
7. The pendulum stops due to [2]
a. gravity b. lack of energy c. air friction d. its mass OR,
8. A resistance of 5 Ω is connected in the left gap of a meter bridge a. Define is moment of inertia and radius of gyration?
and 15 Ω in the other gap. The position of balancing point from left [2]
side is
 b. Find the expression of moment of inertia of uniform rod about a. State Bragg’s law?
an axis passing through the Centre and perpendicular to its length. [1]
[3] b. Derive Bragg’s equation?
15. .a. Define overtone. [2]
[1] c. An X-rays tube operates at 1.8KV. Find the maximum speed
b. Sketch the wave setup of 1st overtone in a closed organ pipe. of electron striking the anticathode. (Mass of electron = 9.1 x
[1] 10-31kg, e = 1.6 x 10-19 C)
c. Write the relation between the wavelength of the wave setup [2]
during second overtone and the length of the organ pipe in part b. 18. .a. The work function of a sodium metal is 2.3eV. Does the
[1] radiation of wavelength 6000Å cause photoelectric effect from
d. In a experiment using the resonance air column tube, resonance the surface? Give reason.
was observed with an air column when its length was 16.5 cm and [2]
again when it was 51.5 cm. If the frequency of the tuning fork is b. An electron, having 500eV energy, enters at right angle to a
512 Hz, calculate the velocity of uniform magnetic field of 10-4 Tesla. If charge of electron, e = 1.6
sound. x 10-19 C and mass of electron, m = 9.1 x 10-31 kg. Calculate the
[2] radius of its circular orbit.
OR, [3]
a. State and use the formula for
velocity of transverse wave along 19. A beam of electrons is under the potential difference of 50 V
a stretched string. [2] applied across two parallel plates 3 cm apart and a magnetic field
b. A standing wave is produce on a 2m long taut string fixed at both 1× 10-4 T at right angles to each other. [Given; mass of electron =
ends. The speed of the wave is 60m/sec, 9.1 × 10-31 kg].
(i) At what frequency does the string vibrates? [2] i. State the condition necessary for the beam to remain un-
(ii) What is this harmonic called? [1] deflected. Also, sketch the forces acting on the electronic beam.
[2]
ii. If two fields produce no deflection in an electronic beam,
calculate the velocity of electrons.
[2]
iii. Explain what would happen to the nature of motion of the
16. .a. State and explain Kirchhoff’s laws of electronic beam, if the electric field switched off.
electrical circuits. [2] [1]
b. Use Kirchhoff’s laws, to find the E1 and
E2 from figure below. [3] Group C (Long Answer Questions) (3 x 8 = 24)

20. a. Why are sound waves in air regarded as longitudinal and not
17. a. Postulate Bohr’s atomic model? [1] transverse? [2]
b. Calculate the radius of nth orbit of hydrogen atom. b. What do you understand by Laplace’s correction? Discuss the
[2] effect of temperature and pressure on velocity of sound. [3]
c. Find the wavelength of the radiation emitted from hydrogen c. A source of sound of frequency 550Hz emits wave of wavelength
atom when an electron jump from third to second orbit. (R= 1.09 660mm in air at 200C. What is the velocity of sound in air at this
x107m-1) [2] temperature? What would be the velocity of sound at 00C
OR, [2]
 d. What is pressure wave? [1] d. Photon cannot deflect both of electric and magnetic field but
cathode rays deflect, why? Explain.
[2]
21. .a. What is the principle of potentiometer? [1]
b. Why does a galvanometer show null deflection in balanced
condition? [2]
c. Using potentiometer, how can you measure internal resistance of
a cell? [3]
d. Find the emf of a cell which balances against a length of 180cm
of a potentiometer wire. Given potential difference per cm of wire
as 0.006V.[2]
22. .The figure shows the experimental set up of Millikan’s oil drop
experiment.

a. In this experiment, a charged oil drop of mass 3.2x10-14Kg is held

stationary between two parallel plates 6mm apart by applying a
potential difference of 1200V between them. How many excess
electrons does the oil drop carry? [3]
b. Write the significance of Millikan’s oil drop experiment. [1]
c. Discuss the theory of this experiment.
[4]
OR
a. Define photoelectric effect?
[1]
b. Discuss the Einstein photoelectric
equation. [3]
c. A graph regarding photoelectric
effect is shown between the maximum
kinetic energy of electrons and the
frequency of the incident light. On the
basis of the data as shown in the graph,
calculate the work function.
[2]
Class: - 12 Science Set B F. a. voltmeter b. ammeter c. potentiometer d. Slide
wire bridge
Candidates are required to give their answers in their own words as far as 32. What is the interval when a sound is reflected beck from a distance
practicable. object and hits our ears?
The figures in the margin indicate full marks. a. 0.1sec b. 0.8sec c. 0.4sec d. 0.5sec

Group A (Multiple Choice Questions) (1 x 11 = 11) 33. If the radius of the 1st orbit of hydrogen is ‘r’, then the radius of the
3rd orbit of hydrogen is ,
23. The wavelength of the wave following the equation of sound wave 𝑟
𝜋 a. 9r b. 31 ⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡⁡c. 3r d.r3
𝑦 = ⁡2⁡𝑆𝑖𝑛⁡(314𝑡⁡ − ⁡2𝑥⁡ + ⁡⁡ 2⁡)⁡𝑖𝑠
a. 2m b. 3.14m c. 6.28m d. undetermined
24. For minima, the path difference between two waves must be Group - B (Short Answer Questions) (8 x 5 = 40)
a. λ b. 2λ c. 3λ d. λ/2
25. In SHM, the particle velocity is maximum at
a. mean position b. Extreme position 12. a. Define angular momentum and write its SI unit.
c. at a distance A/2 d. at a distance A/4 [2]
26. The picture shows two identical waves travelling towards each
other. When the meet they will add to b. A ballet dancer spins with 2.4 rev/s with her arms outstretched
form a standing wave. The point when the moment of inertia about the axis of rotation is I. With
marked with a P will be her arms folded, the moment of inertia about the same axis
a. a node becomes 0.6I. Calculate the new rate of spin.
b. an antinode [3]

c. neither node nor antinode 13.a. Write any one special character of simple harmonic motion.
[1]
d. midway between a nor and antinode

27. Power in rotational motion is b. Obtain an expression for time period of simple pendulum.
a. τω b. τm [3]
c. Calculate the number of oscillations a simple pendulum does in
c. τt d. τ
2 minutes if its time period is 0.5 seconds.
28. If the polar ice caps melt and spread uniformly then the length of
[1]
day
a. 24 hrs. b. more than 24 hrs. c. less than 24 hrs. d. 12 hrs.
14. a. Describe surface tension and surface energy.
29. If a liquid does not wet a solid surface, then its angle of contact is;
a. acute angle b. obtuse angle c. right angle d. None of [2]
above. b. The surface tension of water at 21ºC is 72.75 x 10-3 N m-1. A
30. A resistance of 5 Ω is connected in the left gap of a meter bridge 33.24% (vol. /vol.) solution of ethanol has γ = 33.24 x 10-3 N m-1
and 15 Ω in the other gap. The position of balancing point from left at the same temperature. Given density (solution) = 0.9614 x 103
side is kg m-3 and density (water) = 0.9982 x 103 kg m-3. How much less
a. 25 cm b. 50 cm c. 75 cm d. 100 cm will the alcohol solution rise in the same capillary? Angle of
31. Which of the following instrument is used to measure e.m.f. of a contact, Ө= 0º. [3]
cell accurately?
 OR .
a. Define is moment of inertia and radius of gyration?
[2]
b. Find the expression of moment of inertia of uniform rod about
an axis passing through the Centre and perpendicular to its length.
[ 3]

15. a. Define overtone. 17.a. Define excitation and ionization energy.

[1] [1]
b. Sketch the wave setup of 1st overtone in a open organ pipe. b. Calculate the radius of nth orbit of hydrogen atom.
[1] [ 2]
c. Write the relation between the wavelength of the wave setup c. Find the longest and shortest wavelength of Lyman series(
during second overtone and the length of the organ pipe in part b R=1.09 x107 m-1)?
. [1] [2]
d. In an experiment using the resonance air column tube, resonance OR,
was observed with an air column when its length was 16 cm and d. What are X-rays? How do they differ from cathode rays?.
again when it was 50 cm. If the frequency of the tuning fork is 512 [2]
Hz, calculate the velocity of sound. e. How is the intensity of X-rays controlled in the tube?
[2] [1]
OR; f. Find de Broglie wavelength of proton of energy 2MeV. (Mass
a. What is end correction? [1] of proton =1.64x10-27 kg, h = 6.625x10-34 Js)
b. How would you use resonance tube to determine [2]
the end correction of tube? [2] 18.
c. The density of oil is 800Kg/m3 and water is
1000Kg/m3. Calculate the height h of the column of the
oil shown in figure. [2]

16. a. State and explain Kirchhoff’s laws of electrical circuits.

[2]

b.
 21. a. What is the principle of potentiometer?
[1]

b. Why does a galvanometer show null deflection in balanced

c. What would be the maximum KE of photoelectrons if the condition? [2]
metal A is illuminated by the radiation of 6.6 x 1014 Hz? c. Using potentiometer, how can you compare the emf of two
[2] cells? [3]
d. A potentiometer wire has a length of 2 m and a resistance of
19. A beam of electrons is under the potential difference of 50 V applied
10 ohm. It is connected in series with a cell of emf 4 V and
across two parallel plates 3 cm apart and a magnetic field 1× 10-4 T at
internal resistance 6 ohm. Find the potential gradient on the
right angles to each other. [Given; mass of electron = 9.1 × 10-31 kg]. wire. Find also where a cell of e.m.f. 1 volt will balance on the
i) State the condition necessary for the beam to remain un-deflected. wire. [2]
Also, sketch the forces acting on the electronic beam. 22. The figure shows the experimental set up of Millikan’s oil drop
[2] experiment.

ii) If two fields produce no deflection in an electronic beam, calculate

the velocity of electrons.
[2]

iii) Explain what would happen to the nature of motion of the electronic
beam, if the electric field switched off.
[1]

a. An oil drop of radius 10-5 m carries a charge equal to that of three

electrons. If the density of oil is 2 x 103 kg/m3, find the electric field
required to keep it stationary. [3]
Group - C (Long Answer Questions) (3 x 8 = 24)
b. Write the significance of Millikan’s oil drop experiment. [1]
c. Discuss the theory of this experiment.
[4]
20. a. Write Newton’s equation for velocity of sound in air. OR,
[1] a. Explain, why photoelectric effect cannot be observed
with all wavelength of light?
b. What correction was applied by Laplace’ and why?
[2]
[3]
b. Derive Einstein photoelectric equation.
c. At normal temperature and pressure, 4g of helium occupies a
[3]
volume of 22.4 liter. Determine the speed of sound in helium. For
c. A graph regarding photoelectric effect is
helium, γ = 1.67 and 1atm.pressure = 105Nm-2.
shown between the maximum kinetic energy
[2]
of electrons and the frequency of the incident
d. When sound travels through the medium, the temperature at
light. On the basis of the data as shown in the
various pints does not remain the same? Explain.
graph, calculate the work function. [2]
[2]
d. What is a photon? [1]
Class: - 12 Science Set A OR
Sub: - Chemistry Consider a reaction [2+2+1]
Attempt all the questions. NaNO2 / HCl
SOCl2 NH3 Br 2 / KOH
A B C D E
GROUP A Δ

Tick the correct answer. [1 × 11 The compound E is a primary alcohol which give positive iodoform test. Identify A,
= 11] B, C, D and E.

1. The unit of rate constant depends upon 14. A carbonyl compound X gives iodoform test and can be obtained by oxidation
a. Number of reactants b. Concertation of terms of monohydric alcohol containing three carbon atoms.
c. Order of reaction d. Molecularity of reaction I. Write down the structural formula of X
2. The first product of oxidation of a primary alcohol is II. Give functional isomer of X giving IUPAC name.
a. ketone b. ester c. acetaldehyde d. propanal III. How is X prepared from 2,2-dichloropropane.
3. Which of the following has the greatest bond energy? IV. Write reactions for the conversion of X into 2-hydroxy-2-
a. N-H b. H-H c. H-F d. C-H methylpropanoic acid.
4. CuSO4 is not stored in aluminium bottle because V. What is the laboratory test of carbonyl compound?
a. Cu gets oxidized b. Cu gets reduced [1+1+1+1+1]
c. Al gets reduced d. CuSO4 gets decomposed 15. i. Write any three preparation of ethanoic acid.
5. Bell metal is an alloy of [3]
a. Cu,Pb and Sn b. Sn and Cu c. Zn and Pb d. Zn,Cu and Sn ii. How is ethanoic acid converted into methanoic acid?
6. Haloforms are Tri-halogen derivatives of [2]
a. ethane b. methane c. propane d. benzene 16. i. Write one example of each octahedral complex and tetrahedral complex.
7. Iodoform test will not give by [2]
a. CH3CHO b. CH3COCH3 c. 2-pentanone d. 3-pentanone ii. What is meant by d-d transitions?
8. Acetone can be obtained by oxidation of [1]
a. Ethanol b. n-propanol c. iso-propanol d. iso-butanol iii. List the characteristics of transition metals.
9. Ethane is prepared by the electrolysis of [2]
a. Sodium formate b. Sodium acetate OR
c. Sodium oxalate d. Sodium propanoate
X is an ore of a metal M. X on calcination gives black precipitate W of metal
10. Which radio-isotope is used to detect blood clot?
oxide which belongs to group II of basic radicals in qualitative analysis. X on
a. Co-60 b. As-74 c.Na-24 d. I-131
roasting gives the metal M and a gas as major byproduct. The gas when passed
11. The total amount of energy in the universe is fix but
through an acidified K2Cr2O7 solutions turns green.
a. Matter is increasing b. Gravitation is decreasing
c. Disorder is increasing d. Lightening is increasing I. Identify the metal M
II. Write the reaction involved during calcination of X
III. Write the action of the gas on acidified K2Cr2O7
IV. Convert metal M into its vitriol. [1+1+1+2]

GROUP B 17. For a reaction 2X + 2Y  2XY, the following data were obtained by
Give short answer to the questions. [5 × 8 = 40] experiment.
12 i. Give two chemicals reaction for the preparation of chlorobenzene.[2] Expt. X (mol L-1) Y (mol L-1) Initial rate (mol L-1 s-1)
ii. Why does it gives ortho and para products during electrophilic substitution 1 0.10 0.10 1.3 × 10-4
reaction? [2] 2 0.10 0.20 2.6 × 10-4
iii. Give its action with chloral. [1] 3 0.20 0.20 1.04 × 10-3
13. a Write structure of primary, secondary and tertiary alcohol.
[1] I. Find the order of reaction with respect to X, Y and overall reaction.
b. How can you distinguish Ethanol from propan-2-ol by Victor Meyer’s [3]
method? [4]
 II. Find the rate constants with its units. d. Write the chemistry of blue vitriol.
[1] [3]
III. What is the initial rate of the reaction when the initial concentration of OR
X and Y are 1M and 0.5M respectively? An organic compound (A) when heated with Ag-powder gives C2H2 and form
[1] carbonyl chloride when exposed to air.
18. i. What is meant by nuclear reaction? Give an example of it. i. Identify compound A.
[1+1] [1]
ii. Distinguish between controlled and uncontrolled nuclear fission. ii. Write the reaction for the laboratory method of preparation of A.
[3] [2]
19. What is meant by electrochemical cell and galvanic cell? iii. What happens when compound A is treated with conc. HNO 3?
[2] [2]
The standard electrode potential are: iv. Convert A into methanoic acid.
E° Cu+2/Cu = +0.34 V and E° Ag+/Ag = +0.80 V [2]
I. Construct cell notation for a galvanic cell indicating anode and cathode v. Why compound A is stored in dark brown bottle containing little ethyl
[1] alcohol? [1]
II. Calculate Emf of the cell. [1]
III. Will the reaction Cu+ + 2Ag+  Cu2+ + Ag, occur?
[1]

GROUP C
Give long answer to the questions. [8× 3 =
24]

20. a. Define Heat of formation. Calculate the heat of formation of benzene, Carbon
dioxide and water at 298K is -3280 KJ, -395KJ and -286 KJ respectively.
Calculate the heat of formation of benzene.
[1+4]
b. Explain all factors which affects the rate of chemicals reactions.
[3]
21. Write an example of: [1
× 8 = 8]
a. Reimer-Tiemann reaction
b. Wurtz fittig reaction
c. Oxo-process
d. Cannizzaro’s reaction
e. Tollen’s test
f. Hell-Volhard Zelinsky reaction
g. Decarboxylation reaction
h. Iodoform test
22. a. Write the two postulates of CFT.
[2]
b. Write the examples of monodentate and bidentate ligands? [2]
c. Name the catalyst used in Haber’s process.
[1]
Class: - 12 Science Set B 13. An aliphatic compound A reacts with SOCl2 to give B. B on reduction with H2
Sub: - Chemistry in presence of Pd/BaSO4 to give C. When HCN is added to C produces D. On
Attempt all the questions. hydrolysis of D in acidic medium forms E. Compound C can be obtained by
heating a mixture of sodium formate and sodium acetate. Identify A, B, C, D,
GROUP A and E with reaction sequence.
[5]
Rewrite the correct option in your answer sheet. [11×1 OR
= 11] i. Write down the Structure of primary, Secondary and tertiary alcohol.
[1]
1. The rate of a chemical reaction is independent of ii. Distinguish propan-1-ol from propan-2-ol by Victor Meyer’s test
a. Molecularity b. Nature of reactant [4]
c. Concentration of reactants d. temperature of reaction 14. A carbonyl compound M is used as nail polish remover. The compound M
2. The total amount of energy in the universe is fix but contains three carbons atoms and undergoes iodoform test.
a. Matter is increasing b. Gravitation is decreasing
c. Disorder is increasing d. Lightening is increasing i. Identify the compound M
3. Which radio-isotope is used to detect blood clot?
a. Co-60 b. As-74 c.Na-24 d. I-131 ii. Write down a chemical reaction for the preparation of M
4. Without losing its concentration ZnCl2 solution can’t be kept in contact with
iii. How is M converted into propane?
a. Au b. Al c. Pb d. Ag
5. Which element is added with copper to form bronze? iv. Predict the final product obtained when M is heated with CH3MgI in the
a. Fe b . Mn c. Sn d. Zn presence of dry ether and following by hydrolysis?

6. Choloform does not react with v. Give a laboratory test reaction of carbonyl compound
a. Ethyl amine b. Acetone c. Phenol d. Carbontetrachloride [1+1+1+1+1]
7. Which of the following is a neutral compound?
15. Write suitable reaction to convert ethanoic acid into
a. CH3COOH b. C6H5OH c. C2H5OH d. CH3NH2
8. The first product of oxidation of a primary alcohol is i. Methane
a. ketone b. ester c. acetaldehyde d. propanal
9. Acetic anhydride is formed by distilling acetic acid with ii. Methylethanoate
a. P2O5 b. CaO c. NaOH d. PCl5
10. Which of the following has the greatest bond energy? iii. Ethanoic anhydride
a. N-H b. H-H c. H-F d. C-H
iv. Convert formic acid into ethanoic acid?
11. Iodoform test will not give by
a. CH3CHO b. CH3COCH3 c. 2-pentanone d. 3-pentanone [1+1+1=2]

16. i. What is meant by d-d transitions? [1]

ii. List the characteristics of transition metals. [2]
Iii. Write one example of each octahedral complex and tetrahedral complex. [2]
GROUP B

Give short answer to the following questions. [8 × 5 = OR

40] X is an ore of a metal M. X on calcination gives black precipitate W of metal
oxide which belongs to group II of basic radicals in qualitative analysis. X on
12. i. Write any two methods of preparation of chlorobenzene.
roasting gives the metal M and a gas as major byproduct. The gas when passed
[2]
through an acidified KMnO4 solutions turns colourless.
ii. How does it react with Chloral and Methyl chloride in the presence of dry ether?
i. Identify the metal M
[2]
iii. Write the reaction of Dehydrohalogenation ii. Write the reaction involved during calcination of X
[1]
 iii. Write the action of the gas on acidified KMnO4. iii. Aldol condensation

iv. Convert metal M into its red oxide of copper. iv. Rosenmund’s reduction
[1+2+1+1]
v. DNP test
17. The following rate data were obtained for a chemical reaction.
2A + 2B  C + D vi. Carbonylation reaction
Expt. A (mol L-1) B (mol L-1) Initial rate (mol L-1 s-1) vii. Wolff- Kishner reaction
1 0.1 0.1 6 × 10-3
2 0.3 0.2 7.2 × 10-2 viii. Cannizzaro’s reaction
3 0.3 0.4 2.88 × 10-1
22. a. What is Bessemerization process?
4 0.4 0.1 2.4 × 10-2
[1]
I. Write the data in rate law equation. [1]
b. Write the Chemical equations which take place during Bessemerization?
II. Write the order of reaction with respect to each other and overall.
[3]
[2]
c. How is copper sulphate pentahydrate obtained from copper? [2]
III. Find out the unit of rate constant for the overall reaction.
d. What is the effect of heat on blue vitriol?
[2]
[2]
18. i. What are nuclear isotopes? Write the example of it. [1+1]
OR
ii. Distinguish between controlled and uncontrolled nuclear fission.
[3] Reaction 1 Reaction 2 H2O / H+
A C3H8O B (C5H10O2) C+D
19. What is meant by standard hydrogen electrode? Write its application.
[1+1] The compound (A) is C3H6O which give positive Tollen’s and Fehling’s test.
The standard electrode potential is E° Zn/Zn+2 = -0.76 V and E° Fe+3/Fe+2 =
+0.77 V i. Identify the compound (A) and write the test reaction.
IV. Construct cell notation for a galvanic cell indicating anode and cathode. [2]
[1]
V. Calculate emf of the cell. ii. Complete the reaction 1 and reaction 2.
[1] [2]
VI. Will the reaction Zn2+ + 2Fe2+  Zn + Fe3+, occur?
[1] iii. Draw the structure of compound D.
GROUP C [1]
Give long answer to the following questions. [8 × 3= iv. Identify C and D with proper reaction.
24]
[1]
20. Hess’s law is applied to calculate different types of enthalpy of reaction.
I. Illustrate the Hess law of constant heat summation. v. What happens when, compound B react with sodium ethoxide and also write
[2] the name of reaction.
II. Standard enthalpy of combustion of Carbon, Hydrogen and C 2H2 are - [2]
394 KJ, -286 KJ and -1300 KJ respectively. Calculate the heat of
formation of acetylene.
[4]
III. Draw the energy profile diagram of exothermic and endothermic
reaction. [2]
21. Write an example of each. [1 × 8 = 8]

i. Clemmensen’s reduction

ii. Fehling’s test

Class: - 12 Science /Management Set A
Sub: - Computer Science Class: - 12 Science/Management Set B
Multiple choice question [1*9] Sub: - Computer Science
1. Which key is used to uniquely identify each record in database? Multiple choice question (1*9=9)
A. Unique key b. primary key 1) DBMS is a types of ………. software
B. Key record d.field name A. application softwaer b.system software c.general software d.both b and
2.which of the following is not a DML statement? c
A.CREATE b.SELECT c.INSERT d. DELETE 2) A database language concerned with the definition of the whole database
3.Size of MAC address is……….. structure and schema is:
A. 32 Bits B.48 Bits C.64Bits D.128 bit A. DCL( data control language)
4.The Information to be transmitted in data communication system is called…… B. DDL( data definition language)
C. DML( datamanipulationl language)
A.protocol b.medium c.communication d.message
D. ALL of the above
5.……….topology require hub or central controller
3) what is use for database security?
A.star B.Mesh c.bus d.ring A. Data encryption b.password c.finger print d.all of the above
6.Which features of oop illustrated the code reusability ? 4) radio broaadcast system is an example of………transmission
A. Ploymorphism B.Abstraction c.Encapsulation d.Inheritance A. simplex b. halfe duplex c. full duplex d.none of the above
7. which one is not the features of structured programming? 5) wireless medium is also called………medium
A. Focus on algorithm A. guided b.unguided c.unbounded d.both b and c
B. Follow top down approach of programming 6) the feature of oop in which object of one class acquire the feature of object of
C. Data abstraction another class is……
D. Procedural abstraction A. Encapsulation b. data abstraction c. inheritance d.polymorphism
8 which is not a type of big data? 7) which one is not the features of structured programming?
A. Structured B.well structured A. Focus on algorithm b. follow top down approach of programming
B. semi-Structured D.UN-Structured B. Data abstraction c. procedural abstraction
9 best product to sell in B2C is 8) which is not the type of big data
A.fresh product b. small product c. digital product d.all of the above A. structured b well-structured c semi structured d.un-structured
SHORT ANSWER QUESTION [5*5=25] 9) which of the following system provide limited storage to the user?
1 what is centralized database? And explain DML (2.5+2.5) A.paas b.iaas c.saas d.all of the above
2 what is OSI model of networking Short question answer 5*5=25
3 define the term e-commerce, e-governance , e-business,e-learning
4 compare the object oriented programming and procedural programming language 1)what is database model explain its types
5 what is SQL? Describe any two statement of dml and ddl 2What is dbms? Explain the advantage and disadvantage of dbms
3) Different between LAN AND WAN
LONG ANSWER QUESTION [2*8]
4)What is cloud computing? Explain the types of cloud services
1. What is normalization? Explain 1NF,2NF,3NF with suitable example
5)What is inheritance and polymorphism?
2.What is transmission medium? Explain the guided transmission medium
Or Long question answer 2*8-16
What is network architecture ?explain P2P and client server with advantage and 1) What is topology?draw diagram and Explain bus,star ring topology with advantages
disadvantage and disadvantages
2) what is normalization? Explain normalization process with example
Or
What is osi model? Explain the function of each layer
Class: - 12 Science Set - A Class: - 12 Science Set - B
Sub: - Biology Sub: - Biology
ZOOLOGY ZOOLOGY
Very short question (1x6=6) Very short question (1x6=6)
1. Dental formula of adult man 13. Dental formula of child.
a.2123/2124 b. 2123/2123 c. 2143/2143 d. 2102/2102 a.2123/2124 b. 2123/2123 c. 2143/2143 d. 2102/2102

2. Excretory system of man is 2. Excretory system of man is

a. septa b. setae c. Nephridia d. Kidney a. septa b. setae c. Nephridia d.
3. Tricuspid valve is found in between Kidney
a. Left atrium and left ventricle b. Right atrium and right ventricle 3. Bicuspid valve is found in between
c. Both A and B d. none
4. Eustachan valve is found in. a. Left atrium and left ventricle b. Right atrium and right ventricle
a. superior venacava b. inferior venacava c. Both A and B d. none
c. both a and b d.none 4. Aids disease is caused by.
5. Mast cell is found in a. Rhino virus b. Retro virus c. both a and b d.none
a. epithelial tissue b. Connective tissue 5. Mast cell is found in
c. Muscularbtissue d. none of the above a. epithelial tissue b. Connective tissue
6. Causative agent of typhoid is. c. Muscular tissue d. none of the above
a. Salmonella typhi b. Mycobacterium 6. Causative agent of tuberculosis is.
c. Retro virus d. none a. Salmonella typhi b. Mycobacterium
c. Retro virus d. none
Short Answer question(4x4=16)
7. Describe the structure and function of livers. Short Answer question(4x4=16)
8. Explain the mcchanism of breathing in human with well labelled diagram. 7. Describe the structure and function of pancreas.
9. Explain the processes of gastrulation in frog. 8. Explain the processes of spermatogenesis with well labelled diagram.
10. Write the difference between unstriated and striated muscle . 9. Write the difference between unstriated and striated muscle .
or 10. Discuss the structure of neuron with labelled diagram.
Discuss the bohrs effect with will labelled diagram.
Long Answer Questions(8x2=16) Long Answer Questions(8x2=16)
11. Describe the alimentary canal of man with well labelled diagram.
12. What is disease. Describe the causative agent , mode of infection , incubation 14. 11. Describe the respiratory organs of man with well labelled diagram.
period, symptoms,diagnosis,prevention and treatment of tuberculosis. 15. 12. What is disease. Describe the causative agent , mode of infection , incubation
period, symptoms,diagnosis,prevention and treatment of cholera.
Grade: XII Subject: Biology (Botany - A) 7. Answer the following questions based on the given figure:

Candidates are required to give the answers in their own words as far as a. In the given figure, among A and B, which solution has a higher
practicable. Figures in the margin indicate the full marks. osmotic pressure?
Candidates are required to write Part-I (Botany) and Part-II (Zoology) in
separate answer sheets.
Part I [Botany]
GROUP A [𝟓 × 𝟏 = 𝟓]
Rewrite the most appropriate option for each question in your answer
sheet.
1. Stomatal aperture opens when the guard cells are
a. Flaccid c. Turgid
(1)
b. Kidney-shaped d. Dumb-bell shaped b. Define osmosis.
2. A cell placed in hypertonic solution for plasmolysis, the space between (1)
the cell wall and plasmolysed contents is filled with c. In which direction will osmosis occur, why? (1)
d. Among solutions, A and B, which solution has higher osmotic
a. Water c. Hypertonic solution pressure? Justify your answer.
b. Cell sap d. Hypotonic solution (1)

3. Endosperm in angiosperms is
a. Haploid c. Diploid 8. Define megasporogenesis. Describe the process of upto the formation
of female gametophyte.
b. Triploid d. Tetraploid (1+3)
4. Where do you the vascular bundle as shown in the diagram? 9. Differentiate between transpiration and guttation. (4)
a. Dicot root c. Monocot leaf GROUP C [𝟐⁡ × 𝟖 = 𝟏𝟔]
b. Dicot stem d. Monocot stem Give long answers to the following questions.
10. Describe the process of the development of dicot embryo with well-
5. Which of the following is responsible for labeled diagrams. Also, compare it with monocot embryo. (6+2)
secondary growth?
11. Describe the anatomical structure of a dicot root and compare it with
a. Cambium c. Pericycle
monocot root. (5+3)
b. Parenchyma d. Endodermis
OR
GROUP B [𝟒 × 𝟒 = 𝟏𝟔]
Describe in detail about the structure and functions of complex
Give short answers to the following questions.
permanent tissue with well-labeled diagrams. Also, differentiate between
6. Write a brief note on the structure and functions of parenchyma.
meristematic and permanent tissue. (6+2)
(4)
Grade: XII Subject: Biology (Botany- B) a. Meristematic c. Simple permanent
Candidates are required to give the answers in their own words as far as
b. Complex permanent d. Laticiferous
practicable. Figures in the margin indicate the full marks.
Candidates are required to write Part-I (Botany) and Part-II (Zoology) in GROUP B [𝟒 × 𝟒 = 𝟏𝟔]
separate answer sheets. Give short answers to the following questions.
Part I [Botany] 6. What is simple permanent tissue? Explain the structure and functions
GROUP A [𝟓 × 𝟏 = 𝟓] of parenchyma. (1+3)
Rewrite the most appropriate option for each question in your answer
7. Study the experimental setup in the figure and then answer the following
sheet. questions based on the given figure. (4)
1. Two cells A and B are separated by a semi-permeable membrane as
shown in the diagram. The osmotic pressure (OP) of cell A is 20 atm and a. What phenomenon is being studied by this setup?
that of B is 15 atm. The turgor pressure (TP) of A is 15 and that of B is 12 b. What is semi-permeable
atm. In which direction will the water move? membrane?
c. In which direction will
Cell A Cell B osmosis occur, why?
OP= 20 atm OP= 15 atm
TP=15 atm TP=12 atm d. What will you observe in
the setup after about half an
hour? Give a reason for your answer.
a. From cell A to cell B c. Do not move 8. Define microgametogenesis. Describe the process with possible
b. From cell B to cell A d. DPD=OP diagrams. (4)
2. Female gametophyte in angiosperm is 9. Define transpiration. Describe its various types. (1+3)
a. Egg c. Polar nuclei GROUP C [𝟐⁡ × 𝟖 = 𝟏𝟔]
b. Embryo sac d. Synergids Give long answers to the following questions.
3. Plasmolysis occur when cell is kept in a 10. What is double fertilization triple fusion? Describe the process upto
the formation of zygote. Also briefly describe the product of triple fusion.
a. Hypertonic solution c. Isotonic solution
(2+4+2)
b. Hypotonic solution d. Pure water
11. Describe the anatomical structure of a monocot root and compare it
4. The diagram given is specialized by centripetal metaxylem. What is this with dicot root. (5+3)
condition called? OR
a. Exarch c. Endarch Define simple permanent tissue. Describe its types in detail. Also
b. Centrach d. Mesarch differentiate between simple permanent and complex permanent
tissue. (1+5+2)
5. The tissue that has capacity to divide is called
HAPPY DASHAIN & SUBHA DIPAWALI